| Name | N-[2-[(2-bromo-4,6-dinitrophenyl)azo]-5-(diethylamino)-4-methoxyphenyl]acetamide |
| Synonyms | c.i. 113395 DISPERSE BLUE 291 Ambicron Blue SEGBL C.I. Disperse Blue 2 Disperse Navy Blue S-BGF300 5-(2-bromo-4,6-dinitrophenylazo)-2-N,N-diethylamino-p-Acetanisidide 2'-[(2-bromo-4,6-dinitrophenyl) azo]-5'-diethylamino-p-Acetanisidide 2'-[(2-Bromo-4,6-dinitrophenyl) azo]-5'-(diethylamino)-p-acetanisidide Acetamide, N-2-(2-bromo-4,6-dinitrophenyl)azo-5-(diethylamino)-4-methoxyphenyl- N-[2-[(2-bromo-4,6-dinitrophenyl)azo]-5-(diethylamino)-4-methoxyphenyl]acetamide N-{2-[(E)-(2-bromo-4,6-dinitrophenyl)diazenyl]-5-(diethylamino)-4-methoxyphenyl}acetamide |
| CAS | 56548-64-2 |
| EINECS | 260-255-0 |
| InChI | InChI=1/C19H21BrN6O6/c1-5-24(6-2)16-9-14(21-11(3)27)15(10-18(16)32-4)22-23-19-13(20)7-12(25(28)29)8-17(19)26(30)31/h7-10H,5-6H2,1-4H3,(H,21,27) |
| Molecular Formula | C19H21BrN6O6 |
| Molar Mass | 509.31 |
| Density | 1.54 |
| Boling Point | 700.4±60.0 °C(Predicted) |
| Flash Point | 377.4°C |
| Vapor Presure | 1.82E-19mmHg at 25°C |
| pKa | 13.43±0.70(Predicted) |
| Refractive Index | 1.638 |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| use | dispersed navy blue 5G is used for dyeing and printing polyester and its fabrics, suitable for high temperature and high pressure dyeing and hot melt dyeing. |
| Production method | Using 2, 4-dinitro-6-bromoaniline and 3-acetamido-6-methoxy-N, N-diethylaniline as raw materials, first diazotization of 2, 4-dinitro-6-bromoaniline, and then with 3-acetamido-6-methoxy-N,N-diethylaniline coupling is the product.. |